C15H14BrClN2O3 — CID 51256893
methyl 3-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-3-(2-chlorophenyl)propanoate (PubChem CID 51256893) has the molecular formula C15H14BrClN2O3 and a molecular weight of 385.65 g/mol. Its IUPAC name is methyl 3-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-3-(2-chlorophenyl)propanoate.
| Compound Name | methyl 3-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-3-(2-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 51256893 |
| Molecular Formula | C15H14BrClN2O3 |
| Molecular Weight | 385.65 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | methyl 3-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-3-(2-chlorophenyl)propanoate |
| SMILES | COC(=O)CC(NC(=O)c1cc(Br)c[nH]1)c1ccccc1Cl |
| InChI | InChI=1S/C15H14BrClN2O3/c1-22-14(20)7-12(10-4-2-3-5-11(10)17)19-15(21)13-6-9(16)8-18-13/h2-6,8,12,18H,7H2,1H3,(H,19,21) |
| InChIKey | DGLVTTMEFRLAPR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.65 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |