C16H17BrN2O3 — CID 55440281
methyl 3-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-3-(4-methylphenyl)propanoate (PubChem CID 55440281) has the molecular formula C16H17BrN2O3 and a molecular weight of 365.23 g/mol. Its IUPAC name is methyl 3-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-3-(4-methylphenyl)propanoate.
| Compound Name | methyl 3-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 55440281 |
| Molecular Formula | C16H17BrN2O3 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | methyl 3-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-3-(4-methylphenyl)propanoate |
| SMILES | COC(=O)CC(NC(=O)c1cc(Br)c[nH]1)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H17BrN2O3/c1-10-3-5-11(6-4-10)13(8-15(20)22-2)19-16(21)14-7-12(17)9-18-14/h3-7,9,13,18H,8H2,1-2H3,(H,19,21) |
| InChIKey | KWQOZIZRMVUTPG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |