C16H15BrN2O4 — CID 51284399
methyl 3-(4-bromophenyl)-3-[(1-oxidopyridin-1-ium-4-carbonyl)amino]propanoate (PubChem CID 51284399) has the molecular formula C16H15BrN2O4 and a molecular weight of 379.21 g/mol. Its IUPAC name is methyl 3-(4-bromophenyl)-3-[(1-oxidopyridin-1-ium-4-carbonyl)amino]propanoate.
| Compound Name | methyl 3-(4-bromophenyl)-3-[(1-oxidopyridin-1-ium-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 51284399 |
| Molecular Formula | C16H15BrN2O4 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | methyl 3-(4-bromophenyl)-3-[(1-oxidopyridin-1-ium-4-carbonyl)amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1cc[n+]([O-])cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H15BrN2O4/c1-23-15(20)10-14(11-2-4-13(17)5-3-11)18-16(21)12-6-8-19(22)9-7-12/h2-9,14H,10H2,1H3,(H,18,21) |
| InChIKey | WSYHKAOKGRFXKL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|