C17H15BrClNO4 — CID 68869406
methyl 3-(4-bromophenyl)-3-[(5-chloro-2-hydroxybenzoyl)amino]propanoate (PubChem CID 68869406) has the molecular formula C17H15BrClNO4 and a molecular weight of 412.67 g/mol. Its IUPAC name is methyl 3-(4-bromophenyl)-3-[(5-chloro-2-hydroxybenzoyl)amino]propanoate.
| Compound Name | methyl 3-(4-bromophenyl)-3-[(5-chloro-2-hydroxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 68869406 |
| Molecular Formula | C17H15BrClNO4 |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | methyl 3-(4-bromophenyl)-3-[(5-chloro-2-hydroxybenzoyl)amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1cc(Cl)ccc1O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H15BrClNO4/c1-24-16(22)9-14(10-2-4-11(18)5-3-10)20-17(23)13-8-12(19)6-7-15(13)21/h2-8,14,21H,9H2,1H3,(H,20,23) |
| InChIKey | ZDRIBUFJZRFPQD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |