C15H13BrClNO4 — CID 51314456
methyl 3-(4-bromophenyl)-3-[(5-chlorofuran-2-carbonyl)amino]propanoate (PubChem CID 51314456) has the molecular formula C15H13BrClNO4 and a molecular weight of 386.63 g/mol. Its IUPAC name is methyl 3-(4-bromophenyl)-3-[(5-chlorofuran-2-carbonyl)amino]propanoate.
| Compound Name | methyl 3-(4-bromophenyl)-3-[(5-chlorofuran-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 51314456 |
| Molecular Formula | C15H13BrClNO4 |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | methyl 3-(4-bromophenyl)-3-[(5-chlorofuran-2-carbonyl)amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1ccc(Cl)o1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H13BrClNO4/c1-21-14(19)8-11(9-2-4-10(16)5-3-9)18-15(20)12-6-7-13(17)22-12/h2-7,11H,8H2,1H3,(H,18,20) |
| InChIKey | FVERWHKJCWDAHI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |