C16H20BrNO4 — CID 51256962
methyl 3-(4-bromophenyl)-3-(oxane-4-carbonylamino)propanoate (PubChem CID 51256962) has the molecular formula C16H20BrNO4 and a molecular weight of 370.24 g/mol. Its IUPAC name is methyl 3-(4-bromophenyl)-3-(oxane-4-carbonylamino)propanoate.
| Compound Name | methyl 3-(4-bromophenyl)-3-(oxane-4-carbonylamino)propanoate |
|---|---|
| PubChem CID | 51256962 |
| Molecular Formula | C16H20BrNO4 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | methyl 3-(4-bromophenyl)-3-(oxane-4-carbonylamino)propanoate |
| SMILES | COC(=O)CC(NC(=O)C1CCOCC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H20BrNO4/c1-21-15(19)10-14(11-2-4-13(17)5-3-11)18-16(20)12-6-8-22-9-7-12/h2-5,12,14H,6-10H2,1H3,(H,18,20) |
| InChIKey | IQKXWDWMQLPZQA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |