C14H16FNO4 — CID 124704267
(3R)-3-(4-fluorophenyl)-3-[[(3R)-oxolane-3-carbonyl]amino]propanoic acid (PubChem CID 124704267) has the molecular formula C14H16FNO4 and a molecular weight of 281.28 g/mol. Its IUPAC name is (3R)-3-(4-fluorophenyl)-3-[[(3R)-oxolane-3-carbonyl]amino]propanoic acid.
| Compound Name | (3R)-3-(4-fluorophenyl)-3-[[(3R)-oxolane-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 124704267 |
| Molecular Formula | C14H16FNO4 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (3R)-3-(4-fluorophenyl)-3-[[(3R)-oxolane-3-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)C[C@@H](NC(=O)[C@@H]1CCOC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H16FNO4/c15-11-3-1-9(2-4-11)12(7-13(17)18)16-14(19)10-5-6-20-8-10/h1-4,10,12H,5-8H2,(H,16,19)(H,17,18)/t10-,12-/m1/s1 |
| InChIKey | BFYJDPYFKKJGBJ-ZYHUDNBSSA-N |
| XLogP | 1.49 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |