C15H17ClFNO4 — CID 124700631
(3S)-3-(4-chloro-3-fluorophenyl)-3-[[(3S)-oxane-3-carbonyl]amino]propanoic acid (PubChem CID 124700631) has the molecular formula C15H17ClFNO4 and a molecular weight of 329.75 g/mol. Its IUPAC name is (3S)-3-(4-chloro-3-fluorophenyl)-3-[[(3S)-oxane-3-carbonyl]amino]propanoic acid.
| Compound Name | (3S)-3-(4-chloro-3-fluorophenyl)-3-[[(3S)-oxane-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 124700631 |
| Molecular Formula | C15H17ClFNO4 |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | (3S)-3-(4-chloro-3-fluorophenyl)-3-[[(3S)-oxane-3-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)[C@H]1CCCOC1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C15H17ClFNO4/c16-11-4-3-9(6-12(11)17)13(7-14(19)20)18-15(21)10-2-1-5-22-8-10/h3-4,6,10,13H,1-2,5,7-8H2,(H,18,21)(H,19,20)/t10-,13-/m0/s1 |
| InChIKey | ZAEQECWTDXICHD-GWCFXTLKSA-N |
| XLogP | 2.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |