C14H15ClFNO4 — CID 124514051
methyl (2S)-2-(4-chloro-3-fluorophenyl)-2-[[(3R)-oxolane-3-carbonyl]amino]acetate (PubChem CID 124514051) has the molecular formula C14H15ClFNO4 and a molecular weight of 315.73 g/mol. Its IUPAC name is methyl (2S)-2-(4-chloro-3-fluorophenyl)-2-[[(3R)-oxolane-3-carbonyl]amino]acetate.
| Compound Name | methyl (2S)-2-(4-chloro-3-fluorophenyl)-2-[[(3R)-oxolane-3-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 124514051 |
| Molecular Formula | C14H15ClFNO4 |
| Molecular Weight | 315.73 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | methyl (2S)-2-(4-chloro-3-fluorophenyl)-2-[[(3R)-oxolane-3-carbonyl]amino]acetate |
| SMILES | COC(=O)[C@@H](NC(=O)[C@@H]1CCOC1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C14H15ClFNO4/c1-20-14(19)12(8-2-3-10(15)11(16)6-8)17-13(18)9-4-5-21-7-9/h2-3,6,9,12H,4-5,7H2,1H3,(H,17,18)/t9-,12+/m1/s1 |
| InChIKey | UURLSFLLEHQQCY-SKDRFNHKSA-N |
| XLogP | 1.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.73 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |