C13H15ClFNO2 — CID 129433195
(3S)-N-(4-chloro-3-fluorophenyl)-N-ethyloxolane-3-carboxamide (PubChem CID 129433195) has the molecular formula C13H15ClFNO2 and a molecular weight of 271.72 g/mol. Its IUPAC name is (3S)-N-(4-chloro-3-fluorophenyl)-N-ethyloxolane-3-carboxamide.
| Compound Name | (3S)-N-(4-chloro-3-fluorophenyl)-N-ethyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 129433195 |
| Molecular Formula | C13H15ClFNO2 |
| Molecular Weight | 271.72 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (3S)-N-(4-chloro-3-fluorophenyl)-N-ethyloxolane-3-carboxamide |
| SMILES | CCN(C(=O)[C@H]1CCOC1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C13H15ClFNO2/c1-2-16(13(17)9-5-6-18-8-9)10-3-4-11(14)12(15)7-10/h3-4,7,9H,2,5-6,8H2,1H3/t9-/m0/s1 |
| InChIKey | KAXUUIAQEWCWRG-VIFPVBQESA-N |
| XLogP | 2.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.72 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |