C13H14F3NO2 — CID 95629587
(3S)-N-phenyl-N-(2,2,2-trifluoroethyl)oxolane-3-carboxamide (PubChem CID 95629587) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is (3S)-N-phenyl-N-(2,2,2-trifluoroethyl)oxolane-3-carboxamide.
| Compound Name | (3S)-N-phenyl-N-(2,2,2-trifluoroethyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 95629587 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (3S)-N-phenyl-N-(2,2,2-trifluoroethyl)oxolane-3-carboxamide |
| SMILES | O=C([C@H]1CCOC1)N(CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H14F3NO2/c14-13(15,16)9-17(11-4-2-1-3-5-11)12(18)10-6-7-19-8-10/h1-5,10H,6-9H2/t10-/m0/s1 |
| InChIKey | KURGOSNPDXBQCK-JTQLQIEISA-N |
| XLogP | 2.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |