C16H22FNO2 — CID 71862058
N-[1-(3-fluorophenyl)-2,2-dimethylpropyl]oxolane-3-carboxamide (PubChem CID 71862058) has the molecular formula C16H22FNO2 and a molecular weight of 279.35 g/mol. Its IUPAC name is N-[1-(3-fluorophenyl)-2,2-dimethylpropyl]oxolane-3-carboxamide.
| Compound Name | N-[1-(3-fluorophenyl)-2,2-dimethylpropyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 71862058 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-[1-(3-fluorophenyl)-2,2-dimethylpropyl]oxolane-3-carboxamide |
| SMILES | CC(C)(C)C(NC(=O)C1CCOC1)c1cccc(F)c1 |
| InChI | InChI=1S/C16H22FNO2/c1-16(2,3)14(11-5-4-6-13(17)9-11)18-15(19)12-7-8-20-10-12/h4-6,9,12,14H,7-8,10H2,1-3H3,(H,18,19) |
| InChIKey | VDSNHCRQKRYHRH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |