C12H14FNO3 — CID 130385199
[1-(3-fluorophenyl)-2,2-dimethyl-3-oxopropyl]carbamic acid (PubChem CID 130385199) has the molecular formula C12H14FNO3 and a molecular weight of 239.25 g/mol. Its IUPAC name is [1-(3-fluorophenyl)-2,2-dimethyl-3-oxopropyl]carbamic acid.
| Compound Name | [1-(3-fluorophenyl)-2,2-dimethyl-3-oxopropyl]carbamic acid |
|---|---|
| PubChem CID | 130385199 |
| Molecular Formula | C12H14FNO3 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | [1-(3-fluorophenyl)-2,2-dimethyl-3-oxopropyl]carbamic acid |
| SMILES | CC(C)(C=O)C(NC(=O)O)c1cccc(F)c1 |
| InChI | InChI=1S/C12H14FNO3/c1-12(2,7-15)10(14-11(16)17)8-4-3-5-9(13)6-8/h3-7,10,14H,1-2H3,(H,16,17) |
| InChIKey | FKVUGNNACZENPS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|