C30H40FN5O3 — CID 140518501
N-[(1S)-3-[5-(1-cyclobutyl-3,5-dimethylpyrazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-(3-fluorophenyl)propyl]oxolane-3-carboxamide (PubChem CID 140518501) has the molecular formula C30H40FN5O3 and a molecular weight of 537.68 g/mol. Its IUPAC name is N-[(1S)-3-[5-(1-cyclobutyl-3,5-dimethylpyrazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-(3-fluorophenyl)propyl]oxolane-3-carboxamide.
| Compound Name | N-[(1S)-3-[5-(1-cyclobutyl-3,5-dimethylpyrazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-(3-fluorophenyl)propyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 140518501 |
| Molecular Formula | C30H40FN5O3 |
| Molecular Weight | 537.68 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | N-[(1S)-3-[5-(1-cyclobutyl-3,5-dimethylpyrazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-(3-fluorophenyl)propyl]oxolane-3-carboxamide |
| SMILES | Cc1nn(C2CCC2)c(C)c1C(=O)N1CC2CN(CC[C@H](NC(=O)C3CCOC3)c3cccc(F)c3)CC2C1 |
| InChI | InChI=1S/C30H40FN5O3/c1-19-28(20(2)36(33-19)26-7-4-8-26)30(38)35-16-23-14-34(15-24(23)17-35)11-9-27(21-5-3-6-25(31)13-21)32-29(37)22-10-12-39-18-22/h3,5-6,13,22-24,26-27H,4,7-12,14-18H2,1-2H3,(H,32,37)/t22?,23?,24?,27-/m0/s1 |
| InChIKey | NLOLINTZMUHPKA-LFTRXOAISA-N |
| XLogP | 3.65 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.68 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |