C27H30Cl3N3O3 — CID 91270068
N-[3-[(3aS)-5-(2,3,6-trichlorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide (PubChem CID 91270068) has the molecular formula C27H30Cl3N3O3 and a molecular weight of 550.91 g/mol. Its IUPAC name is N-[3-[(3aS)-5-(2,3,6-trichlorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide.
| Compound Name | N-[3-[(3aS)-5-(2,3,6-trichlorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 91270068 |
| Molecular Formula | C27H30Cl3N3O3 |
| Molecular Weight | 550.91 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | N-[3-[(3aS)-5-(2,3,6-trichlorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide |
| SMILES | O=C(NC(CCN1CC2CN(C(=O)c3c(Cl)ccc(Cl)c3Cl)C[C@@H]2C1)c1ccccc1)C1CCOC1 |
| InChI | InChI=1S/C27H30Cl3N3O3/c28-21-6-7-22(29)25(30)24(21)27(35)33-14-19-12-32(13-20(19)15-33)10-8-23(17-4-2-1-3-5-17)31-26(34)18-9-11-36-16-18/h1-7,18-20,23H,8-16H2,(H,31,34)/t18?,19-,20?,23?/m0/s1 |
| InChIKey | NDSZQQNDBVTYBA-GNERAIRZSA-N |
| XLogP | 4.93 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.91 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|