C29H33N5O3 — CID 11714218
N-[3-[(3aS)-5-(quinoxaline-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide (PubChem CID 11714218) has the molecular formula C29H33N5O3 and a molecular weight of 499.62 g/mol. Its IUPAC name is N-[3-[(3aS)-5-(quinoxaline-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide.
| Compound Name | N-[3-[(3aS)-5-(quinoxaline-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 11714218 |
| Molecular Formula | C29H33N5O3 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | N-[3-[(3aS)-5-(quinoxaline-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide |
| SMILES | O=C(NC(CCN1CC2CN(C(=O)c3cnc4ccccc4n3)C[C@@H]2C1)c1ccccc1)C1CCOC1 |
| InChI | InChI=1S/C29H33N5O3/c35-28(21-11-13-37-19-21)32-24(20-6-2-1-3-7-20)10-12-33-15-22-17-34(18-23(22)16-33)29(36)27-14-30-25-8-4-5-9-26(25)31-27/h1-9,14,21-24H,10-13,15-19H2,(H,32,35)/t21?,22-,23?,24?/m0/s1 |
| InChIKey | LMTCCSQPRVCIAC-REDCPHJYSA-N |
| XLogP | 2.92 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |