C27H34N4O3 — CID 69149212
2-[(3S)-3-(oxolane-3-carbonylamino)-3-phenylpropyl]-N-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 69149212) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is 2-[(3S)-3-(oxolane-3-carbonylamino)-3-phenylpropyl]-N-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | 2-[(3S)-3-(oxolane-3-carbonylamino)-3-phenylpropyl]-N-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 69149212 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 2-[(3S)-3-(oxolane-3-carbonylamino)-3-phenylpropyl]-N-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | O=C(N[C@@H](CCN1CC2CN(C(=O)Nc3ccccc3)CC2C1)c1ccccc1)C1CCOC1 |
| InChI | InChI=1S/C27H34N4O3/c32-26(21-12-14-34-19-21)29-25(20-7-3-1-4-8-20)11-13-30-15-22-17-31(18-23(22)16-30)27(33)28-24-9-5-2-6-10-24/h1-10,21-23,25H,11-19H2,(H,28,33)(H,29,32)/t21?,22?,23?,25-/m0/s1 |
| InChIKey | NXQUIPODYASIOM-RIFKOICESA-N |
| XLogP | 3.37 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |