C28H37N3O7S — CID 69149337
methyl 2,5-dimethyl-4-[[2-[(3S)-3-(oxolane-3-carbonylamino)-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]furan-3-carboxylate (PubChem CID 69149337) has the molecular formula C28H37N3O7S and a molecular weight of 559.69 g/mol. Its IUPAC name is methyl 2,5-dimethyl-4-[[2-[(3S)-3-(oxolane-3-carbonylamino)-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]furan-3-carboxylate.
| Compound Name | methyl 2,5-dimethyl-4-[[2-[(3S)-3-(oxolane-3-carbonylamino)-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 69149337 |
| Molecular Formula | C28H37N3O7S |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | methyl 2,5-dimethyl-4-[[2-[(3S)-3-(oxolane-3-carbonylamino)-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]furan-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(C)c1S(=O)(=O)N1CC2CN(CC[C@H](NC(=O)C3CCOC3)c3ccccc3)CC2C1 |
| InChI | InChI=1S/C28H37N3O7S/c1-18-25(28(33)36-3)26(19(2)38-18)39(34,35)31-15-22-13-30(14-23(22)16-31)11-9-24(20-7-5-4-6-8-20)29-27(32)21-10-12-37-17-21/h4-8,21-24H,9-17H2,1-3H3,(H,29,32)/t21?,22?,23?,24-/m0/s1 |
| InChIKey | NGZTVYWPVPNRLP-GVWQBGCGSA-N |
| XLogP | 2.52 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |