C29H38N4O4 — CID 69148678
[2-[(3S)-3-(oxolane-3-carbonylamino)-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl] N-(2,6-dimethylphenyl)carbamate (PubChem CID 69148678) has the molecular formula C29H38N4O4 and a molecular weight of 506.65 g/mol. Its IUPAC name is [2-[(3S)-3-(oxolane-3-carbonylamino)-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl] N-(2,6-dimethylphenyl)carbamate.
| Compound Name | [2-[(3S)-3-(oxolane-3-carbonylamino)-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl] N-(2,6-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 69148678 |
| Molecular Formula | C29H38N4O4 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | [2-[(3S)-3-(oxolane-3-carbonylamino)-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl] N-(2,6-dimethylphenyl)carbamate |
| SMILES | Cc1cccc(C)c1NC(=O)ON1CC2CN(CC[C@H](NC(=O)C3CCOC3)c3ccccc3)CC2C1 |
| InChI | InChI=1S/C29H38N4O4/c1-20-7-6-8-21(2)27(20)31-29(35)37-33-17-24-15-32(16-25(24)18-33)13-11-26(22-9-4-3-5-10-22)30-28(34)23-12-14-36-19-23/h3-10,23-26H,11-19H2,1-2H3,(H,30,34)(H,31,35)/t23?,24?,25?,26-/m0/s1 |
| InChIKey | MIDCVIYEHXTKSU-ILVMPNSOSA-N |
| XLogP | 3.91 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |