C28H38N4O4 — CID 69365036
N-[3-[(3aS)-5-(3,5-diethyl-1,2-oxazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide (PubChem CID 69365036) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is N-[3-[(3aS)-5-(3,5-diethyl-1,2-oxazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide.
| Compound Name | N-[3-[(3aS)-5-(3,5-diethyl-1,2-oxazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 69365036 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | N-[3-[(3aS)-5-(3,5-diethyl-1,2-oxazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide |
| SMILES | CCc1noc(CC)c1C(=O)N1CC2CN(CCC(NC(=O)C3CCOC3)c3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C28H38N4O4/c1-3-23-26(25(4-2)36-30-23)28(34)32-16-21-14-31(15-22(21)17-32)12-10-24(19-8-6-5-7-9-19)29-27(33)20-11-13-35-18-20/h5-9,20-22,24H,3-4,10-18H2,1-2H3,(H,29,33)/t20?,21-,22?,24?/m0/s1 |
| InChIKey | SOGSYIUYFOIZNO-NCFYSZOTSA-N |
| XLogP | 3.09 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |