C26H34ClN5O3 — CID 91503671
N-[3-[(3aS)-5-(4-chloro-1-ethylpyrazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide (PubChem CID 91503671) has the molecular formula C26H34ClN5O3 and a molecular weight of 500.04 g/mol. Its IUPAC name is N-[3-[(3aS)-5-(4-chloro-1-ethylpyrazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide.
| Compound Name | N-[3-[(3aS)-5-(4-chloro-1-ethylpyrazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 91503671 |
| Molecular Formula | C26H34ClN5O3 |
| Molecular Weight | 500.04 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | N-[3-[(3aS)-5-(4-chloro-1-ethylpyrazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide |
| SMILES | CCn1ncc(Cl)c1C(=O)N1CC2CN(CCC(NC(=O)C3CCOC3)c3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C26H34ClN5O3/c1-2-32-24(22(27)12-28-32)26(34)31-15-20-13-30(14-21(20)16-31)10-8-23(18-6-4-3-5-7-18)29-25(33)19-9-11-35-17-19/h3-7,12,19-21,23H,2,8-11,13-17H2,1H3,(H,29,33)/t19?,20-,21?,23?/m0/s1 |
| InChIKey | PYRSRXYUCGVMSG-PCTQUHOJSA-N |
| XLogP | 2.84 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.04 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |