C28H32N4O3 — CID 91161605
N-[3-[(3aS)-5-(4-cyanobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide (PubChem CID 91161605) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-[3-[(3aS)-5-(4-cyanobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide.
| Compound Name | N-[3-[(3aS)-5-(4-cyanobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 91161605 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N-[3-[(3aS)-5-(4-cyanobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]oxolane-3-carboxamide |
| SMILES | N#Cc1ccc(C(=O)N2CC3CN(CCC(NC(=O)C4CCOC4)c4ccccc4)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C28H32N4O3/c29-14-20-6-8-22(9-7-20)28(34)32-17-24-15-31(16-25(24)18-32)12-10-26(21-4-2-1-3-5-21)30-27(33)23-11-13-35-19-23/h1-9,23-26H,10-13,15-19H2,(H,30,33)/t23?,24-,25?,26?/m0/s1 |
| InChIKey | ALYQSLUHTMCGIZ-VNGSWXTBSA-N |
| XLogP | 2.85 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |