C15H19F2NO2 — CID 97098048
(3R)-N-[(1S)-1-(2,4-difluorophenyl)butyl]oxolane-3-carboxamide (PubChem CID 97098048) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is (3R)-N-[(1S)-1-(2,4-difluorophenyl)butyl]oxolane-3-carboxamide.
| Compound Name | (3R)-N-[(1S)-1-(2,4-difluorophenyl)butyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 97098048 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (3R)-N-[(1S)-1-(2,4-difluorophenyl)butyl]oxolane-3-carboxamide |
| SMILES | CCC[C@H](NC(=O)[C@@H]1CCOC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H19F2NO2/c1-2-3-14(12-5-4-11(16)8-13(12)17)18-15(19)10-6-7-20-9-10/h4-5,8,10,14H,2-3,6-7,9H2,1H3,(H,18,19)/t10-,14+/m1/s1 |
| InChIKey | VXMLIWDMHDZRCM-YGRLFVJLSA-N |
| XLogP | 2.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |