C16H19F2NO3 — CID 120977047
2-[1-(2,4-difluorophenyl)butylcarbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 120977047) has the molecular formula C16H19F2NO3 and a molecular weight of 311.33 g/mol. Its IUPAC name is 2-[1-(2,4-difluorophenyl)butylcarbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[1-(2,4-difluorophenyl)butylcarbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120977047 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-[1-(2,4-difluorophenyl)butylcarbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | CCCC(NC(=O)C1CCC1C(=O)O)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H19F2NO3/c1-2-3-14(12-5-4-9(17)8-13(12)18)19-15(20)10-6-7-11(10)16(21)22/h4-5,8,10-11,14H,2-3,6-7H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | QHJKPRZCLPKYLL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |