C19H28F2N2O — CID 119816121
N-[1-(2,4-difluorophenyl)butyl]-3-piperidin-3-ylbutanamide (PubChem CID 119816121) has the molecular formula C19H28F2N2O and a molecular weight of 338.44 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)butyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[1-(2,4-difluorophenyl)butyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119816121 |
| Molecular Formula | C19H28F2N2O |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)butyl]-3-piperidin-3-ylbutanamide |
| SMILES | CCCC(NC(=O)CC(C)C1CCCNC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H28F2N2O/c1-3-5-18(16-8-7-15(20)11-17(16)21)23-19(24)10-13(2)14-6-4-9-22-12-14/h7-8,11,13-14,18,22H,3-6,9-10,12H2,1-2H3,(H,23,24) |
| InChIKey | NMVVOSIWDXDUCA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |