C20H19F2NO3 — CID 120975659
2-[1,2-bis(3-fluorophenyl)ethylcarbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 120975659) has the molecular formula C20H19F2NO3 and a molecular weight of 359.37 g/mol. Its IUPAC name is 2-[1,2-bis(3-fluorophenyl)ethylcarbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[1,2-bis(3-fluorophenyl)ethylcarbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120975659 |
| Molecular Formula | C20H19F2NO3 |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-[1,2-bis(3-fluorophenyl)ethylcarbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC1C(=O)NC(Cc1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C20H19F2NO3/c21-14-5-1-3-12(9-14)10-18(13-4-2-6-15(22)11-13)23-19(24)16-7-8-17(16)20(25)26/h1-6,9,11,16-18H,7-8,10H2,(H,23,24)(H,25,26) |
| InChIKey | MMXLZFHKPVXQJZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |