2-(1,4-diphenylbutylcarbamoyl)cyclobutane-1-carboxylic acid

C22H25NO3 — CID 120974597

IUPAC2-(1,4-diphenylbutylcarbamoyl)cyclobutane-1-carboxylic acid
SMILESO=C(O)C1CCC1C(=O)NC(CCCc1ccccc1)c1ccccc1
InChIInChI=1S/C22H25NO3/c24-21(18-14-15-19(18)22(25)26)23-20(17-11-5-2-6-12-17)13-7-10-16-8-3-1-4-9-16/h1-6,8-9,11-12,18-20H,7,10,13-15H2,(H,23,24)(H,25,26)
InChIKeyHFCNVQDQADOWRK-UHFFFAOYSA-N
MW351.45 g/mol
LogP3.98
Rot. Bonds8

About 2-(1,4-diphenylbutylcarbamoyl)cyclobutane-1-carboxylic acid

2-(1,4-diphenylbutylcarbamoyl)cyclobutane-1-carboxylic acid (PubChem CID 120974597) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-(1,4-diphenylbutylcarbamoyl)cyclobutane-1-carboxylic acid.

Molecular Properties

Compound Name2-(1,4-diphenylbutylcarbamoyl)cyclobutane-1-carboxylic acid
PubChem CID120974597
Molecular FormulaC22H25NO3
Molecular Weight351.45 g/mol
Exact Mass351.18
IUPAC Name2-(1,4-diphenylbutylcarbamoyl)cyclobutane-1-carboxylic acid
SMILESO=C(O)C1CCC1C(=O)NC(CCCc1ccccc1)c1ccccc1
InChIInChI=1S/C22H25NO3/c24-21(18-14-15-19(18)22(25)26)23-20(17-11-5-2-6-12-17)13-7-10-16-8-3-1-4-9-16/h1-6,8-9,11-12,18-20H,7,10,13-15H2,(H,23,24)(H,25,26)
InChIKeyHFCNVQDQADOWRK-UHFFFAOYSA-N
XLogP3.98
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500351.45
LogP ≤ 53.98
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(1,4-diphenylbutylcarbamoyl)cyclobutane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,4-diphenylbutylcarbamoyl)cyclobutane-1-carboxylic acid?
The IUPAC name of 2-(1,4-diphenylbutylcarbamoyl)cyclobutane-1-carboxylic acid (CID 120974597) is 2-(1,4-diphenylbutylcarbamoyl)cyclobutane-1-carboxylic acid.
What is the SMILES notation for 2-(1,4-diphenylbutylcarbamoyl)cyclobutane-1-carboxylic acid?
The canonical SMILES for 2-(1,4-diphenylbutylcarbamoyl)cyclobutane-1-carboxylic acid is O=C(O)C1CCC1C(=O)NC(CCCc1ccccc1)c1ccccc1.
What is the InChIKey of 2-(1,4-diphenylbutylcarbamoyl)cyclobutane-1-carboxylic acid?
The InChIKey is HFCNVQDQADOWRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO3/c24-21(18-14-15-19(18)22(25)26)23-20(17-11-5-2-6-12-17)13-7-10-16-8-3-1-4-9-16/h1-6,8-9,11-12,18-20H,7,10,13-15H2,(H,23,24)(H,25,26).
What are the key properties of 2-(1,4-diphenylbutylcarbamoyl)cyclobutane-1-carboxylic acid?
2-(1,4-diphenylbutylcarbamoyl)cyclobutane-1-carboxylic acid has a molecular weight of 351.45 g/mol, XLogP of 3.98, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-diphenylbutylcarbamoyl)cyclobutane-1-carboxylic acid is sourced from PubChem (CID 120974597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).