C25H31N3O2 — CID 112834732
2-N-cyclopropyl-1-N-(1,4-diphenylbutyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 112834732) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-N-cyclopropyl-1-N-(1,4-diphenylbutyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | 2-N-cyclopropyl-1-N-(1,4-diphenylbutyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 112834732 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 2-N-cyclopropyl-1-N-(1,4-diphenylbutyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | O=C(NC1CC1)C1CCCN1C(=O)NC(CCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H31N3O2/c29-24(26-21-16-17-21)23-15-8-18-28(23)25(30)27-22(20-12-5-2-6-13-20)14-7-11-19-9-3-1-4-10-19/h1-6,9-10,12-13,21-23H,7-8,11,14-18H2,(H,26,29)(H,27,30) |
| InChIKey | MPDJJGWJDBTUPY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |