C20H27ClN2O — CID 119341740
3-amino-N-(1,5-diphenylpentyl)propanamide;hydrochloride (PubChem CID 119341740) has the molecular formula C20H27ClN2O and a molecular weight of 346.90 g/mol. Its IUPAC name is 3-amino-N-(1,5-diphenylpentyl)propanamide;hydrochloride.
| Compound Name | 3-amino-N-(1,5-diphenylpentyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119341740 |
| Molecular Formula | C20H27ClN2O |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 3-amino-N-(1,5-diphenylpentyl)propanamide;hydrochloride |
| SMILES | Cl.NCCC(=O)NC(CCCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H26N2O.ClH/c21-16-15-20(23)22-19(18-12-5-2-6-13-18)14-8-7-11-17-9-3-1-4-10-17;/h1-6,9-10,12-13,19H,7-8,11,14-16,21H2,(H,22,23);1H |
| InChIKey | RTTROMUXLNMWSF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|