C19H23NO2 — CID 59924200
N-[(1R)-2-hydroxy-1-phenylethyl]-5-phenylpentanamide (PubChem CID 59924200) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[(1R)-2-hydroxy-1-phenylethyl]-5-phenylpentanamide.
| Compound Name | N-[(1R)-2-hydroxy-1-phenylethyl]-5-phenylpentanamide |
|---|---|
| PubChem CID | 59924200 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-[(1R)-2-hydroxy-1-phenylethyl]-5-phenylpentanamide |
| SMILES | O=C(CCCCc1ccccc1)N[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C19H23NO2/c21-15-18(17-12-5-2-6-13-17)20-19(22)14-8-7-11-16-9-3-1-4-10-16/h1-6,9-10,12-13,18,21H,7-8,11,14-15H2,(H,20,22)/t18-/m0/s1 |
| InChIKey | QQALBDFITHKWKW-SFHVURJKSA-N |
| XLogP | 3.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|