C33H36NO5P — CID 18378501
dibenzyl [2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate (PubChem CID 18378501) has the molecular formula C33H36NO5P and a molecular weight of 557.63 g/mol. Its IUPAC name is dibenzyl [2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate.
| Compound Name | dibenzyl [2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate |
|---|---|
| PubChem CID | 18378501 |
| Molecular Formula | C33H36NO5P |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | dibenzyl [2-phenyl-2-(5-phenylpentanoylamino)ethyl] phosphate |
| SMILES | O=C(CCCCc1ccccc1)NC(COP(=O)(OCc1ccccc1)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H36NO5P/c35-33(24-14-13-17-28-15-5-1-6-16-28)34-32(31-22-11-4-12-23-31)27-39-40(36,37-25-29-18-7-2-8-19-29)38-26-30-20-9-3-10-21-30/h1-12,15-16,18-23,32H,13-14,17,24-27H2,(H,34,35) |
| InChIKey | NYYISGCTVNTWLE-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|