C15H24NO6P — CID 18339793
[(2R)-2-(6-methoxyhexanoylamino)-2-phenylethyl] dihydrogen phosphate (PubChem CID 18339793) has the molecular formula C15H24NO6P and a molecular weight of 345.33 g/mol. Its IUPAC name is [(2R)-2-(6-methoxyhexanoylamino)-2-phenylethyl] dihydrogen phosphate.
| Compound Name | [(2R)-2-(6-methoxyhexanoylamino)-2-phenylethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 18339793 |
| Molecular Formula | C15H24NO6P |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | [(2R)-2-(6-methoxyhexanoylamino)-2-phenylethyl] dihydrogen phosphate |
| SMILES | COCCCCCC(=O)N[C@@H](COP(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C15H24NO6P/c1-21-11-7-3-6-10-15(17)16-14(12-22-23(18,19)20)13-8-4-2-5-9-13/h2,4-5,8-9,14H,3,6-7,10-12H2,1H3,(H,16,17)(H2,18,19,20)/t14-/m0/s1 |
| InChIKey | JSHAINAUIBADAK-AWEZNQCLSA-N |
| XLogP | 2.16 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|