C15H25N2O5P — CID 18339910
[2-(hexylcarbamoylamino)-2-phenylethyl] dihydrogen phosphate (PubChem CID 18339910) has the molecular formula C15H25N2O5P and a molecular weight of 344.35 g/mol. Its IUPAC name is [2-(hexylcarbamoylamino)-2-phenylethyl] dihydrogen phosphate.
| Compound Name | [2-(hexylcarbamoylamino)-2-phenylethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 18339910 |
| Molecular Formula | C15H25N2O5P |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | [2-(hexylcarbamoylamino)-2-phenylethyl] dihydrogen phosphate |
| SMILES | CCCCCCNC(=O)NC(COP(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C15H25N2O5P/c1-2-3-4-8-11-16-15(18)17-14(12-22-23(19,20)21)13-9-6-5-7-10-13/h5-7,9-10,14H,2-4,8,11-12H2,1H3,(H2,16,17,18)(H2,19,20,21) |
| InChIKey | SYOFEARGALYPDB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|