C13H20N2O2 — CID 94740192
1-butyl-3-[(1R)-2-hydroxy-1-phenylethyl]urea (PubChem CID 94740192) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-butyl-3-[(1R)-2-hydroxy-1-phenylethyl]urea.
| Compound Name | 1-butyl-3-[(1R)-2-hydroxy-1-phenylethyl]urea |
|---|---|
| PubChem CID | 94740192 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-butyl-3-[(1R)-2-hydroxy-1-phenylethyl]urea |
| SMILES | CCCCNC(=O)N[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C13H20N2O2/c1-2-3-9-14-13(17)15-12(10-16)11-7-5-4-6-8-11/h4-8,12,16H,2-3,9-10H2,1H3,(H2,14,15,17)/t12-/m0/s1 |
| InChIKey | PQUZWNWGNDWASH-LBPRGKRZSA-N |
| XLogP | 1.82 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|