C17H28NO6P — CID 10090720
[2-(3-methoxyphenyl)-2-(octanoylamino)ethyl] dihydrogen phosphate (PubChem CID 10090720) has the molecular formula C17H28NO6P and a molecular weight of 373.39 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-2-(octanoylamino)ethyl] dihydrogen phosphate.
| Compound Name | [2-(3-methoxyphenyl)-2-(octanoylamino)ethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10090720 |
| Molecular Formula | C17H28NO6P |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [2-(3-methoxyphenyl)-2-(octanoylamino)ethyl] dihydrogen phosphate |
| SMILES | CCCCCCCC(=O)NC(COP(=O)(O)O)c1cccc(OC)c1 |
| InChI | InChI=1S/C17H28NO6P/c1-3-4-5-6-7-11-17(19)18-16(13-24-25(20,21)22)14-9-8-10-15(12-14)23-2/h8-10,12,16H,3-7,11,13H2,1-2H3,(H,18,19)(H2,20,21,22) |
| InChIKey | IEDFAVBCRSCMKM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|