C20H28Cl6NO5P — CID 18339721
[(2R)-2-(octanoylamino)-2-phenylethyl] bis(2,2,2-trichloroethyl) phosphate (PubChem CID 18339721) has the molecular formula C20H28Cl6NO5P and a molecular weight of 606.14 g/mol. Its IUPAC name is [(2R)-2-(octanoylamino)-2-phenylethyl] bis(2,2,2-trichloroethyl) phosphate.
| Compound Name | [(2R)-2-(octanoylamino)-2-phenylethyl] bis(2,2,2-trichloroethyl) phosphate |
|---|---|
| PubChem CID | 18339721 |
| Molecular Formula | C20H28Cl6NO5P |
| Molecular Weight | 606.14 g/mol |
| Exact Mass | 602.98 |
| IUPAC Name | [(2R)-2-(octanoylamino)-2-phenylethyl] bis(2,2,2-trichloroethyl) phosphate |
| SMILES | CCCCCCCC(=O)N[C@@H](COP(=O)(OCC(Cl)(Cl)Cl)OCC(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C20H28Cl6NO5P/c1-2-3-4-5-9-12-18(28)27-17(16-10-7-6-8-11-16)13-30-33(29,31-14-19(21,22)23)32-15-20(24,25)26/h6-8,10-11,17H,2-5,9,12-15H2,1H3,(H,27,28)/t17-/m0/s1 |
| InChIKey | GMZNUTXHCDXQOJ-KRWDZBQOSA-N |
| XLogP | 8.10 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.14 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|