C20H34NO4PS — CID 18378445
N-(2-diethoxyphosphorylsulfanyl-1-phenylethyl)octanamide (PubChem CID 18378445) has the molecular formula C20H34NO4PS and a molecular weight of 415.54 g/mol. Its IUPAC name is N-(2-diethoxyphosphorylsulfanyl-1-phenylethyl)octanamide.
| Compound Name | N-(2-diethoxyphosphorylsulfanyl-1-phenylethyl)octanamide |
|---|---|
| PubChem CID | 18378445 |
| Molecular Formula | C20H34NO4PS |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-(2-diethoxyphosphorylsulfanyl-1-phenylethyl)octanamide |
| SMILES | CCCCCCCC(=O)NC(CSP(=O)(OCC)OCC)c1ccccc1 |
| InChI | InChI=1S/C20H34NO4PS/c1-4-7-8-9-13-16-20(22)21-19(18-14-11-10-12-15-18)17-27-26(23,24-5-2)25-6-3/h10-12,14-15,19H,4-9,13,16-17H2,1-3H3,(H,21,22) |
| InChIKey | DTUQKYXSOKCUCQ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|