C22H32N3O4P — CID 59924219
bis(2-isocyanoethyl) [(2R)-2-(octanoylamino)-2-phenylethyl] phosphite (PubChem CID 59924219) has the molecular formula C22H32N3O4P and a molecular weight of 433.49 g/mol. Its IUPAC name is bis(2-isocyanoethyl) [(2R)-2-(octanoylamino)-2-phenylethyl] phosphite.
| Compound Name | bis(2-isocyanoethyl) [(2R)-2-(octanoylamino)-2-phenylethyl] phosphite |
|---|---|
| PubChem CID | 59924219 |
| Molecular Formula | C22H32N3O4P |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | bis(2-isocyanoethyl) [(2R)-2-(octanoylamino)-2-phenylethyl] phosphite |
| SMILES | [C-]#[N+]CCOP(OCC[N+]#[C-])OC[C@H](NC(=O)CCCCCCC)c1ccccc1 |
| InChI | InChI=1S/C22H32N3O4P/c1-4-5-6-7-11-14-22(26)25-21(20-12-9-8-10-13-20)19-29-30(27-17-15-23-2)28-18-16-24-3/h8-10,12-13,21H,4-7,11,14-19H2,1H3,(H,25,26)/t21-/m0/s1 |
| InChIKey | MPUSNIFYZFZLTI-NRFANRHFSA-N |
| XLogP | 5.32 |
| TPSA | 65.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|