C25H42NO5P — CID 11408727
[(2S)-2-[[(Z)-heptadec-8-enoyl]amino]-2-phenylethyl] dihydrogen phosphate (PubChem CID 11408727) has the molecular formula C25H42NO5P and a molecular weight of 467.59 g/mol. Its IUPAC name is [(2S)-2-[[(Z)-heptadec-8-enoyl]amino]-2-phenylethyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-[[(Z)-heptadec-8-enoyl]amino]-2-phenylethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 11408727 |
| Molecular Formula | C25H42NO5P |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | [(2S)-2-[[(Z)-heptadec-8-enoyl]amino]-2-phenylethyl] dihydrogen phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCC(=O)N[C@H](COP(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C25H42NO5P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18-21-25(27)26-24(22-31-32(28,29)30)23-19-16-15-17-20-23/h9-10,15-17,19-20,24H,2-8,11-14,18,21-22H2,1H3,(H,26,27)(H2,28,29,30)/b10-9-/t24-/m1/s1 |
| InChIKey | KIJYPFMZQWBHOY-OPSAWKISSA-N |
| XLogP | 6.60 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|