C28H49N2O5P — CID 58787914
[(2R)-3-(benzylamino)-2-[[(Z)-octadec-9-enoyl]amino]propyl] dihydrogen phosphate (PubChem CID 58787914) has the molecular formula C28H49N2O5P and a molecular weight of 524.68 g/mol. Its IUPAC name is [(2R)-3-(benzylamino)-2-[[(Z)-octadec-9-enoyl]amino]propyl] dihydrogen phosphate.
| Compound Name | [(2R)-3-(benzylamino)-2-[[(Z)-octadec-9-enoyl]amino]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58787914 |
| Molecular Formula | C28H49N2O5P |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.34 |
| IUPAC Name | [(2R)-3-(benzylamino)-2-[[(Z)-octadec-9-enoyl]amino]propyl] dihydrogen phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@H](CNCc1ccccc1)COP(=O)(O)O |
| InChI | InChI=1S/C28H49N2O5P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-28(31)30-27(25-35-36(32,33)34)24-29-23-26-20-17-16-18-21-26/h9-10,16-18,20-21,27,29H,2-8,11-15,19,22-25H2,1H3,(H,30,31)(H2,32,33,34)/b10-9-/t27-/m1/s1 |
| InChIKey | LSQMZAVOBJNMIF-RKVKURJASA-N |
| XLogP | 6.41 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|