C22H40NO5P — CID 11407751
[(2R)-2-[[(Z)-heptadec-8-enoyl]amino]pent-4-ynyl] dihydrogen phosphate (PubChem CID 11407751) has the molecular formula C22H40NO5P and a molecular weight of 429.54 g/mol. Its IUPAC name is [(2R)-2-[[(Z)-heptadec-8-enoyl]amino]pent-4-ynyl] dihydrogen phosphate.
| Compound Name | [(2R)-2-[[(Z)-heptadec-8-enoyl]amino]pent-4-ynyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 11407751 |
| Molecular Formula | C22H40NO5P |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | [(2R)-2-[[(Z)-heptadec-8-enoyl]amino]pent-4-ynyl] dihydrogen phosphate |
| SMILES | C#CC[C@H](COP(=O)(O)O)NC(=O)CCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C22H40NO5P/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19-22(24)23-21(18-4-2)20-28-29(25,26)27/h2,11-12,21H,3,5-10,13-20H2,1H3,(H,23,24)(H2,25,26,27)/b12-11-/t21-/m1/s1 |
| InChIKey | HGHHZGDMRKKZPW-AXUYNXDZSA-N |
| XLogP | 5.25 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|