C21H43N2O5P — CID 90790864
[(2R)-3-amino-2-(octadec-9-enoylamino)propyl] dihydrogen phosphate (PubChem CID 90790864) has the molecular formula C21H43N2O5P and a molecular weight of 434.56 g/mol. Its IUPAC name is [(2R)-3-amino-2-(octadec-9-enoylamino)propyl] dihydrogen phosphate.
| Compound Name | [(2R)-3-amino-2-(octadec-9-enoylamino)propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 90790864 |
| Molecular Formula | C21H43N2O5P |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | [(2R)-3-amino-2-(octadec-9-enoylamino)propyl] dihydrogen phosphate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)N[C@H](CN)COP(=O)(O)O |
| InChI | InChI=1S/C21H43N2O5P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)23-20(18-22)19-28-29(25,26)27/h9-10,20H,2-8,11-19,22H2,1H3,(H,23,24)(H2,25,26,27)/t20-/m1/s1 |
| InChIKey | PCWJRPGQHNDFDW-HXUWFJFHSA-N |
| XLogP | 4.58 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|