C28H48NO5P — CID 91053074
[(2R)-2-(octadec-9-enoylamino)-4-phenylbutyl] dihydrogen phosphate (PubChem CID 91053074) has the molecular formula C28H48NO5P and a molecular weight of 509.67 g/mol. Its IUPAC name is [(2R)-2-(octadec-9-enoylamino)-4-phenylbutyl] dihydrogen phosphate.
| Compound Name | [(2R)-2-(octadec-9-enoylamino)-4-phenylbutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 91053074 |
| Molecular Formula | C28H48NO5P |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.33 |
| IUPAC Name | [(2R)-2-(octadec-9-enoylamino)-4-phenylbutyl] dihydrogen phosphate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)N[C@H](CCc1ccccc1)COP(=O)(O)O |
| InChI | InChI=1S/C28H48NO5P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-28(30)29-27(25-34-35(31,32)33)24-23-26-20-17-16-18-21-26/h9-10,16-18,20-21,27H,2-8,11-15,19,22-25H2,1H3,(H,29,30)(H2,31,32,33)/t27-/m1/s1 |
| InChIKey | IFUFEUFWINXXQD-HHHXNRCGSA-N |
| XLogP | 7.25 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|