C22H42NO7P — CID 91139897
methyl (2S)-2-(octadec-9-enoylamino)-3-phosphonooxypropanoate (PubChem CID 91139897) has the molecular formula C22H42NO7P and a molecular weight of 463.55 g/mol. Its IUPAC name is methyl (2S)-2-(octadec-9-enoylamino)-3-phosphonooxypropanoate.
| Compound Name | methyl (2S)-2-(octadec-9-enoylamino)-3-phosphonooxypropanoate |
|---|---|
| PubChem CID | 91139897 |
| Molecular Formula | C22H42NO7P |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | methyl (2S)-2-(octadec-9-enoylamino)-3-phosphonooxypropanoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)N[C@@H](COP(=O)(O)O)C(=O)OC |
| InChI | InChI=1S/C22H42NO7P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(24)23-20(22(25)29-2)19-30-31(26,27)28/h10-11,20H,3-9,12-19H2,1-2H3,(H,23,24)(H2,26,27,28)/t20-/m0/s1 |
| InChIKey | RKTVUDUUHMRIJC-FQEVSTJZSA-N |
| XLogP | 4.79 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|