C23H46NO5P — CID 58787967
[(2R)-3-methyl-2-[[(Z)-octadec-9-enoyl]amino]butyl] dihydrogen phosphate (PubChem CID 58787967) has the molecular formula C23H46NO5P and a molecular weight of 447.60 g/mol. Its IUPAC name is [(2R)-3-methyl-2-[[(Z)-octadec-9-enoyl]amino]butyl] dihydrogen phosphate.
| Compound Name | [(2R)-3-methyl-2-[[(Z)-octadec-9-enoyl]amino]butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58787967 |
| Molecular Formula | C23H46NO5P |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | [(2R)-3-methyl-2-[[(Z)-octadec-9-enoyl]amino]butyl] dihydrogen phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](COP(=O)(O)O)C(C)C |
| InChI | InChI=1S/C23H46NO5P/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(25)24-22(21(2)3)20-29-30(26,27)28/h11-12,21-22H,4-10,13-20H2,1-3H3,(H,24,25)(H2,26,27,28)/b12-11-/t22-/m0/s1 |
| InChIKey | FGDBDGRUXKSEIQ-GJCOWUBNSA-N |
| XLogP | 6.27 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|