C19H36NO6P — CID 71604340
[(E,2S,3R)-2-[[(E)-dodec-9-enoyl]amino]-3-hydroxyhept-4-enyl] dihydrogen phosphate (PubChem CID 71604340) has the molecular formula C19H36NO6P and a molecular weight of 405.47 g/mol. Its IUPAC name is [(E,2S,3R)-2-[[(E)-dodec-9-enoyl]amino]-3-hydroxyhept-4-enyl] dihydrogen phosphate.
| Compound Name | [(E,2S,3R)-2-[[(E)-dodec-9-enoyl]amino]-3-hydroxyhept-4-enyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 71604340 |
| Molecular Formula | C19H36NO6P |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | [(E,2S,3R)-2-[[(E)-dodec-9-enoyl]amino]-3-hydroxyhept-4-enyl] dihydrogen phosphate |
| SMILES | CC/C=C/CCCCCCCC(=O)N[C@@H](COP(=O)(O)O)[C@H](O)/C=C/CC |
| InChI | InChI=1S/C19H36NO6P/c1-3-5-7-8-9-10-11-12-13-15-19(22)20-17(16-26-27(23,24)25)18(21)14-6-4-2/h5-7,14,17-18,21H,3-4,8-13,15-16H2,1-2H3,(H,20,22)(H2,23,24,25)/b7-5+,14-6+/t17-,18+/m0/s1 |
| InChIKey | WEQWPBZQHMUPDP-APNKGVEMSA-N |
| XLogP | 3.60 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|