C38H71N2O6P — CID 165321723
2-aminoethyl [(4E,8E,12E)-2-[[(Z)-henicos-11-enoyl]amino]-3-hydroxypentadeca-4,8,12-trienyl] hydrogen phosphate (PubChem CID 165321723) has the molecular formula C38H71N2O6P and a molecular weight of 682.97 g/mol. Its IUPAC name is 2-aminoethyl [(4E,8E,12E)-2-[[(Z)-henicos-11-enoyl]amino]-3-hydroxypentadeca-4,8,12-trienyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(4E,8E,12E)-2-[[(Z)-henicos-11-enoyl]amino]-3-hydroxypentadeca-4,8,12-trienyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165321723 |
| Molecular Formula | C38H71N2O6P |
| Molecular Weight | 682.97 g/mol |
| Exact Mass | 682.50 |
| IUPAC Name | 2-aminoethyl [(4E,8E,12E)-2-[[(Z)-henicos-11-enoyl]amino]-3-hydroxypentadeca-4,8,12-trienyl] hydrogen phosphate |
| SMILES | CC/C=C/CC/C=C/CC/C=C/C(O)C(COP(=O)(O)OCCN)NC(=O)CCCCCCCCC/C=C\CCCCCCCCC |
| InChI | InChI=1S/C38H71N2O6P/c1-3-5-7-9-11-13-15-16-17-18-19-20-21-22-24-26-28-30-32-38(42)40-36(35-46-47(43,44)45-34-33-39)37(41)31-29-27-25-23-14-12-10-8-6-4-2/h6,8,14,17-18,23,29,31,36-37,41H,3-5,7,9-13,15-16,19-22,24-28,30,32-35,39H2,1-2H3,(H,40,42)(H,43,44)/b8-6+,18-17-,23-14+,31-29+ |
| InChIKey | XICFZWCFBHEUTH-KAHPKKASSA-N |
| XLogP | 9.77 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.97 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|