C42H71N2O6P — CID 165185071
2-aminoethyl [(4E,8E)-3-hydroxy-2-[[(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl]amino]hexadeca-4,8-dienyl] hydrogen phosphate (PubChem CID 165185071) has the molecular formula C42H71N2O6P and a molecular weight of 731.01 g/mol. Its IUPAC name is 2-aminoethyl [(4E,8E)-3-hydroxy-2-[[(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl]amino]hexadeca-4,8-dienyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(4E,8E)-3-hydroxy-2-[[(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl]amino]hexadeca-4,8-dienyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165185071 |
| Molecular Formula | C42H71N2O6P |
| Molecular Weight | 731.01 g/mol |
| Exact Mass | 730.50 |
| IUPAC Name | 2-aminoethyl [(4E,8E)-3-hydroxy-2-[[(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl]amino]hexadeca-4,8-dienyl] hydrogen phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)NC(COP(=O)(O)OCCN)C(O)/C=C/CC/C=C/CCCCCCC |
| InChI | InChI=1S/C42H71N2O6P/c1-3-5-7-9-11-13-15-16-17-18-19-20-21-22-23-24-26-28-30-32-34-36-42(46)44-40(39-50-51(47,48)49-38-37-43)41(45)35-33-31-29-27-25-14-12-10-8-6-4-2/h5,7,11,13,16-17,19-20,22-23,25-28,33,35,40-41,45H,3-4,6,8-10,12,14-15,18,21,24,29-32,34,36-39,43H2,1-2H3,(H,44,46)(H,47,48)/b7-5-,13-11-,17-16-,20-19-,23-22-,27-25+,28-26-,35-33+ |
| InChIKey | ARSAGEXJVIHQNU-SXEFKLHLSA-N |
| XLogP | 10.44 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.01 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|