C38H65N2O6P — CID 165260757
2-aminoethyl [(4E,8E)-2-[[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl]amino]-3-hydroxytetradeca-4,8-dienyl] hydrogen phosphate (PubChem CID 165260757) has the molecular formula C38H65N2O6P and a molecular weight of 676.92 g/mol. Its IUPAC name is 2-aminoethyl [(4E,8E)-2-[[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl]amino]-3-hydroxytetradeca-4,8-dienyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(4E,8E)-2-[[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl]amino]-3-hydroxytetradeca-4,8-dienyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165260757 |
| Molecular Formula | C38H65N2O6P |
| Molecular Weight | 676.92 g/mol |
| Exact Mass | 676.46 |
| IUPAC Name | 2-aminoethyl [(4E,8E)-2-[[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl]amino]-3-hydroxytetradeca-4,8-dienyl] hydrogen phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)NC(COP(=O)(O)OCCN)C(O)/C=C/CC/C=C/CCCCC |
| InChI | InChI=1S/C38H65N2O6P/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-21-22-24-26-28-30-32-38(42)40-36(35-46-47(43,44)45-34-33-39)37(41)31-29-27-25-23-12-10-8-6-4-2/h5,7,11-13,15-16,18-19,21-23,29,31,36-37,41H,3-4,6,8-10,14,17,20,24-28,30,32-35,39H2,1-2H3,(H,40,42)(H,43,44)/b7-5-,13-11-,16-15-,19-18-,22-21-,23-12+,31-29+ |
| InChIKey | NGGWTCKWMCICMQ-QFEFAKDCSA-N |
| XLogP | 9.10 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.92 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|