C43H75N2O6P — CID 165206321
2-aminoethyl [(4E,8E,12E)-2-[[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoyl]amino]-3-hydroxynonadeca-4,8,12-trienyl] hydrogen phosphate (PubChem CID 165206321) has the molecular formula C43H75N2O6P and a molecular weight of 747.05 g/mol. Its IUPAC name is 2-aminoethyl [(4E,8E,12E)-2-[[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoyl]amino]-3-hydroxynonadeca-4,8,12-trienyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(4E,8E,12E)-2-[[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoyl]amino]-3-hydroxynonadeca-4,8,12-trienyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165206321 |
| Molecular Formula | C43H75N2O6P |
| Molecular Weight | 747.05 g/mol |
| Exact Mass | 746.54 |
| IUPAC Name | 2-aminoethyl [(4E,8E,12E)-2-[[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoyl]amino]-3-hydroxynonadeca-4,8,12-trienyl] hydrogen phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCC(=O)NC(COP(=O)(O)OCCN)C(O)/C=C/CC/C=C/CC/C=C/CCCCCC |
| InChI | InChI=1S/C43H75N2O6P/c1-3-5-7-9-11-13-15-17-19-20-21-22-23-25-27-29-31-33-35-37-43(47)45-41(40-51-52(48,49)50-39-38-44)42(46)36-34-32-30-28-26-24-18-16-14-12-10-8-6-4-2/h5,7,11,13-14,16-17,19,21-22,26,28,34,36,41-42,46H,3-4,6,8-10,12,15,18,20,23-25,27,29-33,35,37-40,44H2,1-2H3,(H,45,47)(H,48,49)/b7-5-,13-11-,16-14+,19-17-,22-21-,28-26+,36-34+ |
| InChIKey | DXZFKWREGMYTIW-RCNNPCQASA-N |
| XLogP | 11.05 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.05 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|